C61H45N3O2 — CID 18338876
2,6-bis[(E)-2-[4-(4-methoxy-N-naphthalen-1-ylanilino)phenyl]ethenyl]naphthalene-1-carbonitrile (PubChem CID 18338876) has the molecular formula C61H45N3O2 and a molecular weight of 852.05 g/mol. Its IUPAC name is 2,6-bis[(E)-2-[4-(4-methoxy-N-naphthalen-1-ylanilino)phenyl]ethenyl]naphthalene-1-carbonitrile.
| Compound Name | 2,6-bis[(E)-2-[4-(4-methoxy-N-naphthalen-1-ylanilino)phenyl]ethenyl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 18338876 |
| Molecular Formula | C61H45N3O2 |
| Molecular Weight | 852.05 g/mol |
| Exact Mass | 851.35 |
| IUPAC Name | 2,6-bis[(E)-2-[4-(4-methoxy-N-naphthalen-1-ylanilino)phenyl]ethenyl]naphthalene-1-carbonitrile |
| SMILES | COc1ccc(N(c2ccc(/C=C/c3ccc4c(C#N)c(/C=C/c5ccc(N(c6ccc(OC)cc6)c6cccc7ccccc67)cc5)ccc4c3)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C61H45N3O2/c1-65-54-36-32-52(33-37-54)63(60-15-7-11-46-9-3-5-13-57(46)60)50-28-20-43(21-29-50)17-18-45-24-40-56-49(41-45)27-26-48(59(56)42-62)25-19-44-22-30-51(31-23-44)64(53-34-38-55(66-2)39-35-53)61-16-8-12-47-10-4-6-14-58(47)61/h3-41H,1-2H3/b18-17+,25-19+ |
| InChIKey | XJCVRUIYYJUQLP-BRDMOXESSA-N |
| XLogP | 16.32 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.05 |
| LogP ≤ 5 | 16.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|