C58H42N4O2 — CID 74010438
4-isocyano-2,5-bis[2-[4-(4-methoxy-N-naphthalen-1-ylanilino)phenyl]ethenyl]benzonitrile (PubChem CID 74010438) has the molecular formula C58H42N4O2 and a molecular weight of 827.00 g/mol. Its IUPAC name is 4-isocyano-2,5-bis[2-[4-(4-methoxy-N-naphthalen-1-ylanilino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-isocyano-2,5-bis[2-[4-(4-methoxy-N-naphthalen-1-ylanilino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 74010438 |
| Molecular Formula | C58H42N4O2 |
| Molecular Weight | 827.00 g/mol |
| Exact Mass | 826.33 |
| IUPAC Name | 4-isocyano-2,5-bis[2-[4-(4-methoxy-N-naphthalen-1-ylanilino)phenyl]ethenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(C=Cc2ccc(N(c3ccc(OC)cc3)c3cccc4ccccc34)cc2)c(C#N)cc1C=Cc1ccc(N(c2ccc(OC)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C58H42N4O2/c1-60-56-39-45(24-18-41-20-26-48(27-21-41)61(50-30-34-52(63-2)35-31-50)57-16-8-12-43-10-4-6-14-54(43)57)47(40-59)38-46(56)25-19-42-22-28-49(29-23-42)62(51-32-36-53(64-3)37-33-51)58-17-9-13-44-11-5-7-15-55(44)58/h4-39H,2-3H3 |
| InChIKey | GEEVHNFRBAIMAV-UHFFFAOYSA-N |
| XLogP | 15.71 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.00 |
| LogP ≤ 5 | 15.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|