C58H42N4 — CID 22973944
4-isocyano-2,5-bis[(E)-2-[4-(4-methyl-N-naphthalen-1-ylanilino)phenyl]ethenyl]benzonitrile (PubChem CID 22973944) has the molecular formula C58H42N4 and a molecular weight of 795.00 g/mol. Its IUPAC name is 4-isocyano-2,5-bis[(E)-2-[4-(4-methyl-N-naphthalen-1-ylanilino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-isocyano-2,5-bis[(E)-2-[4-(4-methyl-N-naphthalen-1-ylanilino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 22973944 |
| Molecular Formula | C58H42N4 |
| Molecular Weight | 795.00 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 4-isocyano-2,5-bis[(E)-2-[4-(4-methyl-N-naphthalen-1-ylanilino)phenyl]ethenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(/C=C/c2ccc(N(c3ccc(C)cc3)c3cccc4ccccc34)cc2)c(C#N)cc1/C=C/c1ccc(N(c2ccc(C)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C58H42N4/c1-41-18-30-50(31-19-41)61(57-16-8-12-45-10-4-6-14-54(45)57)52-34-24-43(25-35-52)22-28-47-39-56(60-3)48(38-49(47)40-59)29-23-44-26-36-53(37-27-44)62(51-32-20-42(2)21-33-51)58-17-9-13-46-11-5-7-15-55(46)58/h4-39H,1-2H3/b28-22+,29-23+ |
| InChIKey | PNLFVCVHHPACTA-UFSUQUSASA-N |
| XLogP | 16.31 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.00 |
| LogP ≤ 5 | 16.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|