C56H52N6 — CID 74010446
2,5-bis[2-[4-(N-[4-(tert-butylamino)phenyl]anilino)phenyl]ethenyl]-4-isocyanobenzonitrile (PubChem CID 74010446) has the molecular formula C56H52N6 and a molecular weight of 809.07 g/mol. Its IUPAC name is 2,5-bis[2-[4-(N-[4-(tert-butylamino)phenyl]anilino)phenyl]ethenyl]-4-isocyanobenzonitrile.
| Compound Name | 2,5-bis[2-[4-(N-[4-(tert-butylamino)phenyl]anilino)phenyl]ethenyl]-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 74010446 |
| Molecular Formula | C56H52N6 |
| Molecular Weight | 809.07 g/mol |
| Exact Mass | 808.43 |
| IUPAC Name | 2,5-bis[2-[4-(N-[4-(tert-butylamino)phenyl]anilino)phenyl]ethenyl]-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C=Cc2ccc(N(c3ccccc3)c3ccc(NC(C)(C)C)cc3)cc2)c(C#N)cc1C=Cc1ccc(N(c2ccccc2)c2ccc(NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C56H52N6/c1-55(2,3)59-46-26-34-52(35-27-46)61(48-14-10-8-11-15-48)50-30-20-41(21-31-50)18-24-43-39-54(58-7)44(38-45(43)40-57)25-19-42-22-32-51(33-23-42)62(49-16-12-9-13-17-49)53-36-28-47(29-37-53)60-56(4,5)6/h8-39,59-60H,1-6H3 |
| InChIKey | KBHAPCSGAIXOCH-UHFFFAOYSA-N |
| XLogP | 15.81 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.07 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|