C48H34N4O2 — CID 89337671
2,5-bis[2-[4-(N-(4-hydroxyphenyl)anilino)phenyl]ethenyl]benzene-1,4-dicarbonitrile (PubChem CID 89337671) has the molecular formula C48H34N4O2 and a molecular weight of 698.83 g/mol. Its IUPAC name is 2,5-bis[2-[4-(N-(4-hydroxyphenyl)anilino)phenyl]ethenyl]benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis[2-[4-(N-(4-hydroxyphenyl)anilino)phenyl]ethenyl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 89337671 |
| Molecular Formula | C48H34N4O2 |
| Molecular Weight | 698.83 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 2,5-bis[2-[4-(N-(4-hydroxyphenyl)anilino)phenyl]ethenyl]benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(C=Cc2ccc(N(c3ccccc3)c3ccc(O)cc3)cc2)c(C#N)cc1C=Cc1ccc(N(c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C48H34N4O2/c49-33-39-32-38(18-12-36-15-21-44(22-16-36)52(42-9-5-2-6-10-42)46-25-29-48(54)30-26-46)40(34-50)31-37(39)17-11-35-13-19-43(20-14-35)51(41-7-3-1-4-8-41)45-23-27-47(53)28-24-45/h1-32,53-54H |
| InChIKey | WEBWJBZKYDXXAG-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.83 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|