C43H31N3 — CID 157105695
4-isocyano-2-[(Z)-2-(4-methylphenyl)ethenyl]-5-[(Z)-2-[4-(N-(4-phenylphenyl)anilino)phenyl]ethenyl]benzonitrile (PubChem CID 157105695) has the molecular formula C43H31N3 and a molecular weight of 589.74 g/mol. Its IUPAC name is 4-isocyano-2-[(Z)-2-(4-methylphenyl)ethenyl]-5-[(Z)-2-[4-(N-(4-phenylphenyl)anilino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-isocyano-2-[(Z)-2-(4-methylphenyl)ethenyl]-5-[(Z)-2-[4-(N-(4-phenylphenyl)anilino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 157105695 |
| Molecular Formula | C43H31N3 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | 4-isocyano-2-[(Z)-2-(4-methylphenyl)ethenyl]-5-[(Z)-2-[4-(N-(4-phenylphenyl)anilino)phenyl]ethenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(/C=C\c2ccc(C)cc2)c(C#N)cc1/C=C\c1ccc(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H31N3/c1-32-13-15-33(16-14-32)17-21-37-30-43(45-2)38(29-39(37)31-44)22-18-34-19-25-41(26-20-34)46(40-11-7-4-8-12-40)42-27-23-36(24-28-42)35-9-5-3-6-10-35/h3-30H,1H3/b21-17-,22-18- |
| InChIKey | AGGSMCHDWXCKRX-SVJWQLCWSA-N |
| XLogP | 11.90 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|