C54H38N4 — CID 101239718
5-[3-cyano-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]benzonitrile (PubChem CID 101239718) has the molecular formula C54H38N4 and a molecular weight of 742.93 g/mol. Its IUPAC name is 5-[3-cyano-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]benzonitrile.
| Compound Name | 5-[3-cyano-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 101239718 |
| Molecular Formula | C54H38N4 |
| Molecular Weight | 742.93 g/mol |
| Exact Mass | 742.31 |
| IUPAC Name | 5-[3-cyano-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]benzonitrile |
| SMILES | N#Cc1cc(-c2ccc(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)c(C#N)c2)ccc1/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C54H38N4/c55-39-47-37-45(31-29-43(47)27-21-41-23-33-53(34-24-41)57(49-13-5-1-6-14-49)50-15-7-2-8-16-50)46-32-30-44(48(38-46)40-56)28-22-42-25-35-54(36-26-42)58(51-17-9-3-10-18-51)52-19-11-4-12-20-52/h1-38H/b27-21+,28-22+ |
| InChIKey | UYTLIIXOGMGHCX-GPAWKIAZSA-N |
| XLogP | 14.38 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.93 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|