C40H35N5 — CID 59055958
5-[2-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]ethenyl]-2-[2-[4-(dimethylamino)phenyl]ethenyl]-4-isocyanobenzonitrile (PubChem CID 59055958) has the molecular formula C40H35N5 and a molecular weight of 585.76 g/mol. Its IUPAC name is 5-[2-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]ethenyl]-2-[2-[4-(dimethylamino)phenyl]ethenyl]-4-isocyanobenzonitrile.
| Compound Name | 5-[2-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]ethenyl]-2-[2-[4-(dimethylamino)phenyl]ethenyl]-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 59055958 |
| Molecular Formula | C40H35N5 |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 5-[2-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]ethenyl]-2-[2-[4-(dimethylamino)phenyl]ethenyl]-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C=Cc2ccc(N(C)C)cc2)c(C#N)cc1C=Cc1ccc(N(c2ccccc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C40H35N5/c1-42-40-28-32(17-11-30-13-19-35(20-14-30)43(2)3)34(29-41)27-33(40)18-12-31-15-21-38(22-16-31)45(37-9-7-6-8-10-37)39-25-23-36(24-26-39)44(4)5/h6-28H,2-5H3 |
| InChIKey | WOCGNCWATZFOLY-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 37.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|