C60H58N4O4 — CID 22973921
4-isocyano-2,5-bis[(E)-2-[4-(4-propoxy-N-(4-propoxyphenyl)anilino)phenyl]ethenyl]benzonitrile (PubChem CID 22973921) has the molecular formula C60H58N4O4 and a molecular weight of 899.15 g/mol. Its IUPAC name is 4-isocyano-2,5-bis[(E)-2-[4-(4-propoxy-N-(4-propoxyphenyl)anilino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-isocyano-2,5-bis[(E)-2-[4-(4-propoxy-N-(4-propoxyphenyl)anilino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 22973921 |
| Molecular Formula | C60H58N4O4 |
| Molecular Weight | 899.15 g/mol |
| Exact Mass | 898.45 |
| IUPAC Name | 4-isocyano-2,5-bis[(E)-2-[4-(4-propoxy-N-(4-propoxyphenyl)anilino)phenyl]ethenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(/C=C/c2ccc(N(c3ccc(OCCC)cc3)c3ccc(OCCC)cc3)cc2)c(C#N)cc1/C=C/c1ccc(N(c2ccc(OCCC)cc2)c2ccc(OCCC)cc2)cc1 |
| InChI | InChI=1S/C60H58N4O4/c1-6-38-65-56-30-22-52(23-31-56)63(53-24-32-57(33-25-53)66-39-7-2)50-18-12-45(13-19-50)10-16-47-43-60(62-5)48(42-49(47)44-61)17-11-46-14-20-51(21-15-46)64(54-26-34-58(35-27-54)67-40-8-3)55-28-36-59(37-29-55)68-41-9-4/h10-37,42-43H,6-9,38-41H2,1-4H3/b16-10+,17-11+ |
| InChIKey | QBFGTPAQASNCAY-OTYYAQKOSA-N |
| XLogP | 16.54 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.15 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|