C48H45NO3 — CID 122211085
4-[(E)-2-(4-ethoxyphenyl)ethenyl]-N,N-bis[4-[(E)-2-(4-ethoxyphenyl)ethenyl]phenyl]aniline (PubChem CID 122211085) has the molecular formula C48H45NO3 and a molecular weight of 683.89 g/mol. Its IUPAC name is 4-[(E)-2-(4-ethoxyphenyl)ethenyl]-N,N-bis[4-[(E)-2-(4-ethoxyphenyl)ethenyl]phenyl]aniline.
| Compound Name | 4-[(E)-2-(4-ethoxyphenyl)ethenyl]-N,N-bis[4-[(E)-2-(4-ethoxyphenyl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 122211085 |
| Molecular Formula | C48H45NO3 |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.34 |
| IUPAC Name | 4-[(E)-2-(4-ethoxyphenyl)ethenyl]-N,N-bis[4-[(E)-2-(4-ethoxyphenyl)ethenyl]phenyl]aniline |
| SMILES | CCOc1ccc(/C=C/c2ccc(N(c3ccc(/C=C/c4ccc(OCC)cc4)cc3)c3ccc(/C=C/c4ccc(OCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H45NO3/c1-4-50-46-31-19-40(20-32-46)10-7-37-13-25-43(26-14-37)49(44-27-15-38(16-28-44)8-11-41-21-33-47(34-22-41)51-5-2)45-29-17-39(18-30-45)9-12-42-23-35-48(36-24-42)52-6-3/h7-36H,4-6H2,1-3H3/b10-7+,11-8+,12-9+ |
| InChIKey | BLNWLDWGTOCJAY-SRDSWEMOSA-N |
| XLogP | 12.86 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|