C59H48N2O3 — CID 59905392
4-(N-[4-[2-[6-[2-[4-(N-(4-ethoxyphenyl)-4-methoxyanilino)phenyl]ethenyl]anthracen-2-yl]ethenyl]phenyl]-4-methylanilino)benzaldehyde (PubChem CID 59905392) has the molecular formula C59H48N2O3 and a molecular weight of 833.04 g/mol. Its IUPAC name is 4-(N-[4-[2-[6-[2-[4-(N-(4-ethoxyphenyl)-4-methoxyanilino)phenyl]ethenyl]anthracen-2-yl]ethenyl]phenyl]-4-methylanilino)benzaldehyde.
| Compound Name | 4-(N-[4-[2-[6-[2-[4-(N-(4-ethoxyphenyl)-4-methoxyanilino)phenyl]ethenyl]anthracen-2-yl]ethenyl]phenyl]-4-methylanilino)benzaldehyde |
|---|---|
| PubChem CID | 59905392 |
| Molecular Formula | C59H48N2O3 |
| Molecular Weight | 833.04 g/mol |
| Exact Mass | 832.37 |
| IUPAC Name | 4-(N-[4-[2-[6-[2-[4-(N-(4-ethoxyphenyl)-4-methoxyanilino)phenyl]ethenyl]anthracen-2-yl]ethenyl]phenyl]-4-methylanilino)benzaldehyde |
| SMILES | CCOc1ccc(N(c2ccc(C=Cc3ccc4cc5cc(C=Cc6ccc(N(c7ccc(C)cc7)c7ccc(C=O)cc7)cc6)ccc5cc4c3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C59H48N2O3/c1-4-64-59-35-31-57(32-36-59)61(56-29-33-58(63-3)34-30-56)54-25-15-44(16-26-54)8-10-46-12-20-49-39-50-37-45(11-19-48(50)40-51(49)38-46)9-7-43-13-23-53(24-14-43)60(52-21-5-42(2)6-22-52)55-27-17-47(41-62)18-28-55/h5-41H,4H2,1-3H3 |
| InChIKey | KRMAMDPQKHTAAR-UHFFFAOYSA-N |
| XLogP | 15.80 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.04 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|