C43H42N2O4 — CID 123717319
4-(N-(4-formylphenyl)anilino)benzaldehyde;4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline;propane (PubChem CID 123717319) has the molecular formula C43H42N2O4 and a molecular weight of 650.82 g/mol. Its IUPAC name is 4-(N-(4-formylphenyl)anilino)benzaldehyde;4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline;propane.
| Compound Name | 4-(N-(4-formylphenyl)anilino)benzaldehyde;4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline;propane |
|---|---|
| PubChem CID | 123717319 |
| Molecular Formula | C43H42N2O4 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 4-(N-(4-formylphenyl)anilino)benzaldehyde;4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline;propane |
| SMILES | CCC.COc1ccc(N(c2ccccc2)c2ccc(OC)cc2)cc1.O=Cc1ccc(N(c2ccccc2)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C20H19NO2.C20H15NO2.C3H8/c1-22-19-12-8-17(9-13-19)21(16-6-4-3-5-7-16)18-10-14-20(23-2)15-11-18;22-14-16-6-10-19(11-7-16)21(18-4-2-1-3-5-18)20-12-8-17(15-23)9-13-20;1-3-2/h3-15H,1-2H3;1-15H;3H2,1-2H3 |
| InChIKey | ZWJLNZPOMWOSBO-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|