About fluorobenzene;4-methoxybenzaldehyde
fluorobenzene;4-methoxybenzaldehyde (PubChem CID 175119443) has the molecular formula C14H13FO2
and a molecular weight of 232.25 g/mol. Its IUPAC name is fluorobenzene;4-methoxybenzaldehyde.
Molecular Properties
| Compound Name | fluorobenzene;4-methoxybenzaldehyde |
| PubChem CID | 175119443 |
| Molecular Formula | C14H13FO2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | fluorobenzene;4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1.Fc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C6H5F/c1-10-8-4-2-7(6-9)3-5-8;7-6-4-2-1-3-5-6/h2-6H,1H3;1-5H |
| InChIKey | GXEPCBUZDDHMJM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze fluorobenzene;4-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;4-methoxybenzaldehyde?
The IUPAC name of fluorobenzene;4-methoxybenzaldehyde (CID 175119443) is fluorobenzene;4-methoxybenzaldehyde.
What is the SMILES notation for fluorobenzene;4-methoxybenzaldehyde?
The canonical SMILES for fluorobenzene;4-methoxybenzaldehyde is COc1ccc(C=O)cc1.Fc1ccccc1.
What is the InChIKey of fluorobenzene;4-methoxybenzaldehyde?
The InChIKey is GXEPCBUZDDHMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C6H5F/c1-10-8-4-2-7(6-9)3-5-8;7-6-4-2-1-3-5-6/h2-6H,1H3;1-5H.
What are the key properties of fluorobenzene;4-methoxybenzaldehyde?
fluorobenzene;4-methoxybenzaldehyde has a molecular weight of 232.25 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;4-methoxybenzaldehyde is sourced from PubChem (CID 175119443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).