About benzaldehyde;4-methoxyaniline
benzaldehyde;4-methoxyaniline (PubChem CID 159915454) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is benzaldehyde;4-methoxyaniline.
Molecular Properties
| Compound Name | benzaldehyde;4-methoxyaniline |
| PubChem CID | 159915454 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | benzaldehyde;4-methoxyaniline |
| SMILES | COc1ccc(N)cc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H9NO.C7H6O/c1-9-7-4-2-6(8)3-5-7;8-6-7-4-2-1-3-5-7/h2-5H,8H2,1H3;1-6H |
| InChIKey | NXSJTHRBZGWIJL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;4-methoxyaniline?
The IUPAC name of benzaldehyde;4-methoxyaniline (CID 159915454) is benzaldehyde;4-methoxyaniline.
What is the SMILES notation for benzaldehyde;4-methoxyaniline?
The canonical SMILES for benzaldehyde;4-methoxyaniline is COc1ccc(N)cc1.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;4-methoxyaniline?
The InChIKey is NXSJTHRBZGWIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.C7H6O/c1-9-7-4-2-6(8)3-5-7;8-6-7-4-2-1-3-5-7/h2-5H,8H2,1H3;1-6H.
What are the key properties of benzaldehyde;4-methoxyaniline?
benzaldehyde;4-methoxyaniline has a molecular weight of 229.28 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;4-methoxyaniline is sourced from PubChem (CID 159915454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).