About (4-aminophenyl) formate;4-methoxyaniline
(4-aminophenyl) formate;4-methoxyaniline (PubChem CID 145416787) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is (4-aminophenyl) formate;4-methoxyaniline.
Molecular Properties
| Compound Name | (4-aminophenyl) formate;4-methoxyaniline |
| PubChem CID | 145416787 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (4-aminophenyl) formate;4-methoxyaniline |
| SMILES | COc1ccc(N)cc1.Nc1ccc(OC=O)cc1 |
| InChI | InChI=1S/C7H7NO2.C7H9NO/c8-6-1-3-7(4-2-6)10-5-9;1-9-7-4-2-6(8)3-5-7/h1-5H,8H2;2-5H,8H2,1H3 |
| InChIKey | GEVDNJXNJOUECK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) formate;4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) formate;4-methoxyaniline?
The IUPAC name of (4-aminophenyl) formate;4-methoxyaniline (CID 145416787) is (4-aminophenyl) formate;4-methoxyaniline.
What is the SMILES notation for (4-aminophenyl) formate;4-methoxyaniline?
The canonical SMILES for (4-aminophenyl) formate;4-methoxyaniline is COc1ccc(N)cc1.Nc1ccc(OC=O)cc1.
What is the InChIKey of (4-aminophenyl) formate;4-methoxyaniline?
The InChIKey is GEVDNJXNJOUECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C7H9NO/c8-6-1-3-7(4-2-6)10-5-9;1-9-7-4-2-6(8)3-5-7/h1-5H,8H2;2-5H,8H2,1H3.
What are the key properties of (4-aminophenyl) formate;4-methoxyaniline?
(4-aminophenyl) formate;4-methoxyaniline has a molecular weight of 260.29 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) formate;4-methoxyaniline is sourced from PubChem (CID 145416787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).