About ethane;4-methoxyaniline
ethane;4-methoxyaniline (PubChem CID 144603339) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is ethane;4-methoxyaniline.
Molecular Properties
| Compound Name | ethane;4-methoxyaniline |
| PubChem CID | 144603339 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethane;4-methoxyaniline |
| SMILES | CC.CC.COc1ccc(N)cc1 |
| InChI | InChI=1S/C7H9NO.2C2H6/c1-9-7-4-2-6(8)3-5-7;2*1-2/h2-5H,8H2,1H3;2*1-2H3 |
| InChIKey | GSDAAPDXMFSIJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methoxyaniline?
The IUPAC name of ethane;4-methoxyaniline (CID 144603339) is ethane;4-methoxyaniline.
What is the SMILES notation for ethane;4-methoxyaniline?
The canonical SMILES for ethane;4-methoxyaniline is CC.CC.COc1ccc(N)cc1.
What is the InChIKey of ethane;4-methoxyaniline?
The InChIKey is GSDAAPDXMFSIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.2C2H6/c1-9-7-4-2-6(8)3-5-7;2*1-2/h2-5H,8H2,1H3;2*1-2H3.
What are the key properties of ethane;4-methoxyaniline?
ethane;4-methoxyaniline has a molecular weight of 183.29 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methoxyaniline is sourced from PubChem (CID 144603339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).