About 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane
4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane (PubChem CID 145450258) has the molecular formula C22H26N2O2
and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane.
Molecular Properties
| Compound Name | 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane |
| PubChem CID | 145450258 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane |
| SMILES | CC.COc1ccc(N(c2ccc(N)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O2.C2H6/c1-23-19-11-7-17(8-12-19)22(16-5-3-15(21)4-6-16)18-9-13-20(24-2)14-10-18;1-2/h3-14H,21H2,1-2H3;1-2H3 |
| InChIKey | KVNCKUYVSKOOOS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane?
The IUPAC name of 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane (CID 145450258) is 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane.
What is the SMILES notation for 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane?
The canonical SMILES for 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane is CC.COc1ccc(N(c2ccc(N)cc2)c2ccc(OC)cc2)cc1.
What is the InChIKey of 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane?
The InChIKey is KVNCKUYVSKOOOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2.C2H6/c1-23-19-11-7-17(8-12-19)22(16-5-3-15(21)4-6-16)18-9-13-20(24-2)14-10-18;1-2/h3-14H,21H2,1-2H3;1-2H3.
What are the key properties of 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane?
4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane has a molecular weight of 350.46 g/mol, XLogP of 5.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane is sourced from PubChem (CID 145450258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).