C22H26N2O2 — CID 145450258
4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane (PubChem CID 145450258) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane.
| Compound Name | 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane |
|---|---|
| PubChem CID | 145450258 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine;ethane |
| SMILES | CC.COc1ccc(N(c2ccc(N)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O2.C2H6/c1-23-19-11-7-17(8-12-19)22(16-5-3-15(21)4-6-16)18-9-13-20(24-2)14-10-18;1-2/h3-14H,21H2,1-2H3;1-2H3 |
| InChIKey | KVNCKUYVSKOOOS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|