C33H33BrN2O5 — CID 164988135
4-aminophenol;1-bromo-4-methoxybenzene;4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenol (PubChem CID 164988135) has the molecular formula C33H33BrN2O5 and a molecular weight of 617.54 g/mol. Its IUPAC name is 4-aminophenol;1-bromo-4-methoxybenzene;4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenol.
| Compound Name | 4-aminophenol;1-bromo-4-methoxybenzene;4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenol |
|---|---|
| PubChem CID | 164988135 |
| Molecular Formula | C33H33BrN2O5 |
| Molecular Weight | 617.54 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | 4-aminophenol;1-bromo-4-methoxybenzene;4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenol |
| SMILES | COc1ccc(Br)cc1.COc1ccc(N(c2ccc(O)cc2)c2ccc(OC)cc2)cc1.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C20H19NO3.C7H7BrO.C6H7NO/c1-23-19-11-5-16(6-12-19)21(15-3-9-18(22)10-4-15)17-7-13-20(24-2)14-8-17;1-9-7-4-2-6(8)3-5-7;7-5-1-3-6(8)4-2-5/h3-14,22H,1-2H3;2-5H,1H3;1-4,8H,7H2 |
| InChIKey | GLQMEAWRWXFJKY-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.54 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|