About 4-methoxyaniline;hydrobromide
4-methoxyaniline;hydrobromide (PubChem CID 518270) has the molecular formula C7H10BrNO
and a molecular weight of 204.07 g/mol. Its IUPAC name is 4-methoxyaniline;hydrobromide.
Molecular Properties
| Compound Name | 4-methoxyaniline;hydrobromide |
| PubChem CID | 518270 |
| Molecular Formula | C7H10BrNO |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 4-methoxyaniline;hydrobromide |
| SMILES | Br.COc1ccc(N)cc1 |
| InChI | InChI=1S/C7H9NO.BrH/c1-9-7-4-2-6(8)3-5-7;/h2-5H,8H2,1H3;1H |
| InChIKey | RJMOZBXAFVSKRY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxyaniline;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyaniline;hydrobromide?
The IUPAC name of 4-methoxyaniline;hydrobromide (CID 518270) is 4-methoxyaniline;hydrobromide.
What is the SMILES notation for 4-methoxyaniline;hydrobromide?
The canonical SMILES for 4-methoxyaniline;hydrobromide is Br.COc1ccc(N)cc1.
What is the InChIKey of 4-methoxyaniline;hydrobromide?
The InChIKey is RJMOZBXAFVSKRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.BrH/c1-9-7-4-2-6(8)3-5-7;/h2-5H,8H2,1H3;1H.
What are the key properties of 4-methoxyaniline;hydrobromide?
4-methoxyaniline;hydrobromide has a molecular weight of 204.07 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyaniline;hydrobromide is sourced from PubChem (CID 518270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).