C16H22N2O3 — CID 70411207
(2,4-dimethoxyphenyl)methanamine;4-methoxyaniline (PubChem CID 70411207) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methanamine;4-methoxyaniline.
| Compound Name | (2,4-dimethoxyphenyl)methanamine;4-methoxyaniline |
|---|---|
| PubChem CID | 70411207 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2,4-dimethoxyphenyl)methanamine;4-methoxyaniline |
| SMILES | COc1ccc(CN)c(OC)c1.COc1ccc(N)cc1 |
| InChI | InChI=1S/C9H13NO2.C7H9NO/c1-11-8-4-3-7(6-10)9(5-8)12-2;1-9-7-4-2-6(8)3-5-7/h3-5H,6,10H2,1-2H3;2-5H,8H2,1H3 |
| InChIKey | XALCBOLMDGZTLL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|