C12H15NO2 — CID 91200946
4-(2,4-dimethoxyphenyl)but-2-yn-1-amine (PubChem CID 91200946) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)but-2-yn-1-amine.
| Compound Name | 4-(2,4-dimethoxyphenyl)but-2-yn-1-amine |
|---|---|
| PubChem CID | 91200946 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)but-2-yn-1-amine |
| SMILES | COc1ccc(CC#CCN)c(OC)c1 |
| InChI | InChI=1S/C12H15NO2/c1-14-11-7-6-10(5-3-4-8-13)12(9-11)15-2/h6-7,9H,5,8,13H2,1-2H3 |
| InChIKey | VGLVLWRWJFRPJR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|