C9H11IO2 — CID 91883521
1-(iodomethyl)-2,4-dimethoxybenzene (PubChem CID 91883521) has the molecular formula C9H11IO2 and a molecular weight of 278.09 g/mol. Its IUPAC name is 1-(iodomethyl)-2,4-dimethoxybenzene.
| Compound Name | 1-(iodomethyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 91883521 |
| Molecular Formula | C9H11IO2 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 1-(iodomethyl)-2,4-dimethoxybenzene |
| SMILES | COc1ccc(CI)c(OC)c1 |
| InChI | InChI=1S/C9H11IO2/c1-11-8-4-3-7(6-10)9(5-8)12-2/h3-5H,6H2,1-2H3 |
| InChIKey | RSEYAYYXFUCZKQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|