C16H18O3 — CID 173405518
2,4-dimethoxy-1-[(3-methoxyphenyl)methyl]benzene (PubChem CID 173405518) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,4-dimethoxy-1-[(3-methoxyphenyl)methyl]benzene.
| Compound Name | 2,4-dimethoxy-1-[(3-methoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 173405518 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2,4-dimethoxy-1-[(3-methoxyphenyl)methyl]benzene |
| SMILES | COc1cccc(Cc2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C16H18O3/c1-17-14-6-4-5-12(10-14)9-13-7-8-15(18-2)11-16(13)19-3/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | OZAHZKZEPYPYCP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |