C15H19N2O2+ — CID 5045085
(2,4-dimethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium (PubChem CID 5045085) has the molecular formula C15H19N2O2+ and a molecular weight of 259.33 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium.
| Compound Name | (2,4-dimethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 5045085 |
| Molecular Formula | C15H19N2O2+ |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium |
| SMILES | COc1ccc(C[NH2+]Cc2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-18-14-6-5-13(15(8-14)19-2)11-17-10-12-4-3-7-16-9-12/h3-9,17H,10-11H2,1-2H3/p+1 |
| InChIKey | QIKNGLMDKSZFGQ-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |