C16H20NO2+ — CID 6963477
benzyl-[(2,5-dimethoxyphenyl)methyl]azanium (PubChem CID 6963477) has the molecular formula C16H20NO2+ and a molecular weight of 258.34 g/mol. Its IUPAC name is benzyl-[(2,5-dimethoxyphenyl)methyl]azanium.
| Compound Name | benzyl-[(2,5-dimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 6963477 |
| Molecular Formula | C16H20NO2+ |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | benzyl-[(2,5-dimethoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(OC)c(C[NH2+]Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H19NO2/c1-18-15-8-9-16(19-2)14(10-15)12-17-11-13-6-4-3-5-7-13/h3-10,17H,11-12H2,1-2H3/p+1 |
| InChIKey | ANAWJFQLYUXDAP-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |