C18H19N2O2+ — CID 7447354
benzyl-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]azanium (PubChem CID 7447354) has the molecular formula C18H19N2O2+ and a molecular weight of 295.36 g/mol. Its IUPAC name is benzyl-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]azanium.
| Compound Name | benzyl-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 7447354 |
| Molecular Formula | C18H19N2O2+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | benzyl-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]azanium |
| SMILES | COc1ccc2cc(C[NH2+]Cc3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H18N2O2/c1-22-16-8-7-14-9-15(18(21)20-17(14)10-16)12-19-11-13-5-3-2-4-6-13/h2-10,19H,11-12H2,1H3,(H,20,21)/p+1 |
| InChIKey | NDKHGKBLIUQHRS-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |