C14H19N2O+ — CID 2014669
butyl-[(2-oxo-1H-quinolin-3-yl)methyl]azanium (PubChem CID 2014669) has the molecular formula C14H19N2O+ and a molecular weight of 231.32 g/mol. Its IUPAC name is butyl-[(2-oxo-1H-quinolin-3-yl)methyl]azanium.
| Compound Name | butyl-[(2-oxo-1H-quinolin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 2014669 |
| Molecular Formula | C14H19N2O+ |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | butyl-[(2-oxo-1H-quinolin-3-yl)methyl]azanium |
| SMILES | CCCC[NH2+]Cc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C14H18N2O/c1-2-3-8-15-10-12-9-11-6-4-5-7-13(11)16-14(12)17/h4-7,9,15H,2-3,8,10H2,1H3,(H,16,17)/p+1 |
| InChIKey | HFAKGWFHRDAKQY-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 49.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|