C15H17NO3 — CID 17101124
(2-oxo-1H-quinolin-3-yl)methyl pentanoate (PubChem CID 17101124) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2-oxo-1H-quinolin-3-yl)methyl pentanoate.
| Compound Name | (2-oxo-1H-quinolin-3-yl)methyl pentanoate |
|---|---|
| PubChem CID | 17101124 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2-oxo-1H-quinolin-3-yl)methyl pentanoate |
| SMILES | CCCCC(=O)OCc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C15H17NO3/c1-2-3-8-14(17)19-10-12-9-11-6-4-5-7-13(11)16-15(12)18/h4-7,9H,2-3,8,10H2,1H3,(H,16,18) |
| InChIKey | SOMXFBJMUXTOEP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |