C21H21NO3 — CID 946725
(2-oxo-1H-quinolin-3-yl)methyl 4-tert-butylbenzoate (PubChem CID 946725) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2-oxo-1H-quinolin-3-yl)methyl 4-tert-butylbenzoate.
| Compound Name | (2-oxo-1H-quinolin-3-yl)methyl 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 946725 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (2-oxo-1H-quinolin-3-yl)methyl 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCc2cc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-21(2,3)17-10-8-14(9-11-17)20(24)25-13-16-12-15-6-4-5-7-18(15)22-19(16)23/h4-12H,13H2,1-3H3,(H,22,23) |
| InChIKey | DMWSJYBZGKABPB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |