C18H16N2O3 — CID 75403102
methyl 3-[(2-oxo-1H-quinolin-3-yl)methylamino]benzoate (PubChem CID 75403102) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is methyl 3-[(2-oxo-1H-quinolin-3-yl)methylamino]benzoate.
| Compound Name | methyl 3-[(2-oxo-1H-quinolin-3-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 75403102 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | methyl 3-[(2-oxo-1H-quinolin-3-yl)methylamino]benzoate |
| SMILES | COC(=O)c1cccc(NCc2cc3ccccc3[nH]c2=O)c1 |
| InChI | InChI=1S/C18H16N2O3/c1-23-18(22)13-6-4-7-15(10-13)19-11-14-9-12-5-2-3-8-16(12)20-17(14)21/h2-10,19H,11H2,1H3,(H,20,21) |
| InChIKey | RQVKHXQZVBLTAJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |