C23H18N2O2 — CID 110324311
N-[(2-oxo-1H-quinolin-3-yl)methyl]-3-phenylbenzamide (PubChem CID 110324311) has the molecular formula C23H18N2O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[(2-oxo-1H-quinolin-3-yl)methyl]-3-phenylbenzamide.
| Compound Name | N-[(2-oxo-1H-quinolin-3-yl)methyl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 110324311 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[(2-oxo-1H-quinolin-3-yl)methyl]-3-phenylbenzamide |
| SMILES | O=C(NCc1cc2ccccc2[nH]c1=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H18N2O2/c26-22(19-11-6-10-17(13-19)16-7-2-1-3-8-16)24-15-20-14-18-9-4-5-12-21(18)25-23(20)27/h1-14H,15H2,(H,24,26)(H,25,27) |
| InChIKey | REUPAUSAZQPJMS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |