C16H20N2O3 — CID 120510789
(2S)-4-methyl-2-[(2-oxo-1H-quinolin-3-yl)methylamino]pentanoic acid (PubChem CID 120510789) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-4-methyl-2-[(2-oxo-1H-quinolin-3-yl)methylamino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[(2-oxo-1H-quinolin-3-yl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 120510789 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2S)-4-methyl-2-[(2-oxo-1H-quinolin-3-yl)methylamino]pentanoic acid |
| SMILES | CC(C)C[C@H](NCc1cc2ccccc2[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)7-14(16(20)21)17-9-12-8-11-5-3-4-6-13(11)18-15(12)19/h3-6,8,10,14,17H,7,9H2,1-2H3,(H,18,19)(H,20,21)/t14-/m0/s1 |
| InChIKey | VZDAMTJWWASNQI-AWEZNQCLSA-N |
| XLogP | 2.12 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |