C15H12N4O3 — CID 110662606
6-oxo-N-[(2-oxo-1H-quinolin-3-yl)methyl]-1H-pyridazine-3-carboxamide (PubChem CID 110662606) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 6-oxo-N-[(2-oxo-1H-quinolin-3-yl)methyl]-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-[(2-oxo-1H-quinolin-3-yl)methyl]-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 110662606 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 6-oxo-N-[(2-oxo-1H-quinolin-3-yl)methyl]-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCc1cc2ccccc2[nH]c1=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C15H12N4O3/c20-13-6-5-12(18-19-13)15(22)16-8-10-7-9-3-1-2-4-11(9)17-14(10)21/h1-7H,8H2,(H,16,22)(H,17,21)(H,19,20) |
| InChIKey | COUGCHQBHSEEAT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |