C18H14N2O4 — CID 110324306
N-[(2-oxo-1H-quinolin-3-yl)methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 110324306) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-[(2-oxo-1H-quinolin-3-yl)methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2-oxo-1H-quinolin-3-yl)methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 110324306 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-[(2-oxo-1H-quinolin-3-yl)methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCc1cc2ccccc2[nH]c1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N2O4/c21-17(12-5-6-15-16(8-12)24-10-23-15)19-9-13-7-11-3-1-2-4-14(11)20-18(13)22/h1-8H,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | NSZGBLXQSCVIFX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |