C17H14N2O5S — CID 110324331
N-[(2-oxo-1H-quinolin-3-yl)methyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110324331) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is N-[(2-oxo-1H-quinolin-3-yl)methyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[(2-oxo-1H-quinolin-3-yl)methyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110324331 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[(2-oxo-1H-quinolin-3-yl)methyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=c1[nH]c2ccccc2cc1CNS(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N2O5S/c20-17-12(7-11-3-1-2-4-14(11)19-17)9-18-25(21,22)13-5-6-15-16(8-13)24-10-23-15/h1-8,18H,9-10H2,(H,19,20) |
| InChIKey | YKPZEGNGYDXGEG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |