C18H18N4O3 — CID 122179126
N-[3-(1H-benzimidazol-2-ylamino)propyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 122179126) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-ylamino)propyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-ylamino)propyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 122179126 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-ylamino)propyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCCNc1nc2ccccc2[nH]1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18N4O3/c23-17(12-6-7-15-16(10-12)25-11-24-15)19-8-3-9-20-18-21-13-4-1-2-5-14(13)22-18/h1-2,4-7,10H,3,8-9,11H2,(H,19,23)(H2,20,21,22) |
| InChIKey | VRNJSGUQFBELLC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|