C23H18N4O4S — CID 2088527
N'-[4-(1H-benzimidazol-2-ylsulfanylmethyl)benzoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 2088527) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is N'-[4-(1H-benzimidazol-2-ylsulfanylmethyl)benzoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[4-(1H-benzimidazol-2-ylsulfanylmethyl)benzoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 2088527 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N'-[4-(1H-benzimidazol-2-ylsulfanylmethyl)benzoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2c(c1)OCO2)c1ccc(CSc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H18N4O4S/c28-21(26-27-22(29)16-9-10-19-20(11-16)31-13-30-19)15-7-5-14(6-8-15)12-32-23-24-17-3-1-2-4-18(17)25-23/h1-11H,12-13H2,(H,24,25)(H,26,28)(H,27,29) |
| InChIKey | CGXILWFGXGVUQV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|