C22H22N4O2S — CID 24513951
4-(1H-benzimidazol-2-ylsulfanylmethyl)-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide (PubChem CID 24513951) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide |
|---|---|
| PubChem CID | 24513951 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide |
| SMILES | O=C(NNC(=O)C1CC=CCC1)c1ccc(CSc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c27-20(16-6-2-1-3-7-16)25-26-21(28)17-12-10-15(11-13-17)14-29-22-23-18-8-4-5-9-19(18)24-22/h1-2,4-5,8-13,16H,3,6-7,14H2,(H,23,24)(H,25,27)(H,26,28) |
| InChIKey | DVZQXLMUXGXZJU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|