C23H24N4O2S — CID 55340249
[4-[4-(1H-benzimidazol-2-ylsulfanylmethyl)benzoyl]piperazin-1-yl]-cyclopropylmethanone (PubChem CID 55340249) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is [4-[4-(1H-benzimidazol-2-ylsulfanylmethyl)benzoyl]piperazin-1-yl]-cyclopropylmethanone.
| Compound Name | [4-[4-(1H-benzimidazol-2-ylsulfanylmethyl)benzoyl]piperazin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 55340249 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [4-[4-(1H-benzimidazol-2-ylsulfanylmethyl)benzoyl]piperazin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(c1ccc(CSc2nc3ccccc3[nH]2)cc1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C23H24N4O2S/c28-21(26-11-13-27(14-12-26)22(29)18-9-10-18)17-7-5-16(6-8-17)15-30-23-24-19-3-1-2-4-20(19)25-23/h1-8,18H,9-15H2,(H,24,25) |
| InChIKey | RNHIHPXSYZSSNA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |