C26H27N5O4S — CID 2412655
N'-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-4-(1H-benzimidazol-2-ylsulfanylmethyl)benzohydrazide (PubChem CID 2412655) has the molecular formula C26H27N5O4S and a molecular weight of 505.60 g/mol. Its IUPAC name is N'-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-4-(1H-benzimidazol-2-ylsulfanylmethyl)benzohydrazide.
| Compound Name | N'-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-4-(1H-benzimidazol-2-ylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 2412655 |
| Molecular Formula | C26H27N5O4S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | N'-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-4-(1H-benzimidazol-2-ylsulfanylmethyl)benzohydrazide |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)NNC(=O)c1ccc(CSc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C26H27N5O4S/c32-22(13-14-31-24(34)18-5-1-2-6-19(18)25(31)35)29-30-23(33)17-11-9-16(10-12-17)15-36-26-27-20-7-3-4-8-21(20)28-26/h3-4,7-12,18-19H,1-2,5-6,13-15H2,(H,27,28)(H,29,32)(H,30,33)/t18-,19-/m1/s1 |
| InChIKey | OCKBQKFWOALBAK-RTBURBONSA-N |
| XLogP | 3.18 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|