C21H20N4O2S — CID 6520130
4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[(E)-(3-oxocyclohexylidene)amino]benzamide (PubChem CID 6520130) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[(E)-(3-oxocyclohexylidene)amino]benzamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[(E)-(3-oxocyclohexylidene)amino]benzamide |
|---|---|
| PubChem CID | 6520130 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[(E)-(3-oxocyclohexylidene)amino]benzamide |
| SMILES | O=C1CCC/C(=N\NC(=O)c2ccc(CSc3nc4ccccc4[nH]3)cc2)C1 |
| InChI | InChI=1S/C21H20N4O2S/c26-17-5-3-4-16(12-17)24-25-20(27)15-10-8-14(9-11-15)13-28-21-22-18-6-1-2-7-19(18)23-21/h1-2,6-11H,3-5,12-13H2,(H,22,23)(H,25,27)/b24-16+ |
| InChIKey | LJCPZXKUCGVEDN-LFVJCYFKSA-N |
| XLogP | 4.08 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|