C25H24N4OS — CID 3459224
4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[1-(3,4-dimethylphenyl)ethylideneamino]benzamide (PubChem CID 3459224) has the molecular formula C25H24N4OS and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[1-(3,4-dimethylphenyl)ethylideneamino]benzamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[1-(3,4-dimethylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3459224 |
| Molecular Formula | C25H24N4OS |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[1-(3,4-dimethylphenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(CSc2nc3ccccc3[nH]2)cc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C25H24N4OS/c1-16-8-11-21(14-17(16)2)18(3)28-29-24(30)20-12-9-19(10-13-20)15-31-25-26-22-6-4-5-7-23(22)27-25/h4-14H,15H2,1-3H3,(H,26,27)(H,29,30) |
| InChIKey | GWRBLTQTNVWWKR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|