C19H20N4O3 — CID 122179127
N-[3-(1H-benzimidazol-2-ylamino)propyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 122179127) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-ylamino)propyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-ylamino)propyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 122179127 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-ylamino)propyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(NCCCNc1nc2ccccc2[nH]1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H20N4O3/c24-18(13-6-7-16-17(12-13)26-11-10-25-16)20-8-3-9-21-19-22-14-4-1-2-5-15(14)23-19/h1-2,4-7,12H,3,8-11H2,(H,20,24)(H2,21,22,23) |
| InChIKey | ABZZDPJVTGAIEI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|