C19H18Cl2N4O3 — CID 122179076
methyl 2-[3-[(3,5-dichlorobenzoyl)amino]propylamino]-3H-benzimidazole-5-carboxylate (PubChem CID 122179076) has the molecular formula C19H18Cl2N4O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is methyl 2-[3-[(3,5-dichlorobenzoyl)amino]propylamino]-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[3-[(3,5-dichlorobenzoyl)amino]propylamino]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 122179076 |
| Molecular Formula | C19H18Cl2N4O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | methyl 2-[3-[(3,5-dichlorobenzoyl)amino]propylamino]-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NCCCNC(=O)c3cc(Cl)cc(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C19H18Cl2N4O3/c1-28-18(27)11-3-4-15-16(9-11)25-19(24-15)23-6-2-5-22-17(26)12-7-13(20)10-14(21)8-12/h3-4,7-10H,2,5-6H2,1H3,(H,22,26)(H2,23,24,25) |
| InChIKey | WNLJNKWANYRZLI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|