C15H11Cl2N3O2 — CID 82564583
2-[(3,5-dichlorophenyl)methylamino]-3H-benzimidazole-5-carboxylic acid (PubChem CID 82564583) has the molecular formula C15H11Cl2N3O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methylamino]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)methylamino]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82564583 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)methylamino]-3H-benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NCc3cc(Cl)cc(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c16-10-3-8(4-11(17)6-10)7-18-15-19-12-2-1-9(14(21)22)5-13(12)20-15/h1-6H,7H2,(H,21,22)(H2,18,19,20) |
| InChIKey | FXLAYKUAIYIXKC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |