C12H10ClN3S — CID 69311089
6-chloro-N-(thiophen-3-ylmethyl)-1H-benzimidazol-2-amine (PubChem CID 69311089) has the molecular formula C12H10ClN3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 6-chloro-N-(thiophen-3-ylmethyl)-1H-benzimidazol-2-amine.
| Compound Name | 6-chloro-N-(thiophen-3-ylmethyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 69311089 |
| Molecular Formula | C12H10ClN3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 6-chloro-N-(thiophen-3-ylmethyl)-1H-benzimidazol-2-amine |
| SMILES | Clc1ccc2nc(NCc3ccsc3)[nH]c2c1 |
| InChI | InChI=1S/C12H10ClN3S/c13-9-1-2-10-11(5-9)16-12(15-10)14-6-8-3-4-17-7-8/h1-5,7H,6H2,(H2,14,15,16) |
| InChIKey | WGWIMCMVDQCQDZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |