C24H17ClN4OS — CID 44525354
1-[4-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]-3-(4-chlorophenyl)urea (PubChem CID 44525354) has the molecular formula C24H17ClN4OS and a molecular weight of 444.95 g/mol. Its IUPAC name is 1-[4-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[4-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 44525354 |
| Molecular Formula | C24H17ClN4OS |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1-[4-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]-3-(4-chlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(-c2csc(-c3nc4ccccc4[nH]3)c2)cc1 |
| InChI | InChI=1S/C24H17ClN4OS/c25-17-7-11-19(12-8-17)27-24(30)26-18-9-5-15(6-10-18)16-13-22(31-14-16)23-28-20-3-1-2-4-21(20)29-23/h1-14H,(H,28,29)(H2,26,27,30) |
| InChIKey | STJFMUWBKQADGC-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |