C24H18N4OS — CID 44525400
1-[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]-3-thiophen-3-ylurea (PubChem CID 44525400) has the molecular formula C24H18N4OS and a molecular weight of 410.50 g/mol. Its IUPAC name is 1-[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]-3-thiophen-3-ylurea.
| Compound Name | 1-[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 44525400 |
| Molecular Formula | C24H18N4OS |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]-3-thiophen-3-ylurea |
| SMILES | O=C(Nc1ccc(-c2cccc(-c3nc4ccccc4[nH]3)c2)cc1)Nc1ccsc1 |
| InChI | InChI=1S/C24H18N4OS/c29-24(26-20-12-13-30-15-20)25-19-10-8-16(9-11-19)17-4-3-5-18(14-17)23-27-21-6-1-2-7-22(21)28-23/h1-15H,(H,27,28)(H2,25,26,29) |
| InChIKey | ASKVSJONBMFQBL-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |