C22H21N3 — CID 44524235
N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]ethanamine (PubChem CID 44524235) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]ethanamine.
| Compound Name | N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 44524235 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(-c2cccc(-c3nc4ccccc4[nH]3)c2)cc1 |
| InChI | InChI=1S/C22H21N3/c1-2-23-15-16-10-12-17(13-11-16)18-6-5-7-19(14-18)22-24-20-8-3-4-9-21(20)25-22/h3-14,23H,2,15H2,1H3,(H,24,25) |
| InChIKey | ZDJZXSSMWJDRFE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |