C27H23FN4 — CID 44524923
3-[[[4-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methylamino]methyl]aniline (PubChem CID 44524923) has the molecular formula C27H23FN4 and a molecular weight of 422.51 g/mol. Its IUPAC name is 3-[[[4-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methylamino]methyl]aniline.
| Compound Name | 3-[[[4-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methylamino]methyl]aniline |
|---|---|
| PubChem CID | 44524923 |
| Molecular Formula | C27H23FN4 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 3-[[[4-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methylamino]methyl]aniline |
| SMILES | Nc1cccc(CNCc2ccc(-c3cccc(-c4nc5ccc(F)cc5[nH]4)c3)cc2)c1 |
| InChI | InChI=1S/C27H23FN4/c28-23-11-12-25-26(15-23)32-27(31-25)22-5-2-4-21(14-22)20-9-7-18(8-10-20)16-30-17-19-3-1-6-24(29)13-19/h1-15,30H,16-17,29H2,(H,31,32) |
| InChIKey | LZJILSGVOYVKQX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|